C18H19N3O5S — CID 109106519
5-N-(1,1-dioxothiolan-3-yl)-3-N-(3-methoxyphenyl)pyridine-3,5-dicarboxamide (PubChem CID 109106519) has the molecular formula C18H19N3O5S and a molecular weight of 389.43 g/mol. Its IUPAC name is 5-N-(1,1-dioxothiolan-3-yl)-3-N-(3-methoxyphenyl)pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-(1,1-dioxothiolan-3-yl)-3-N-(3-methoxyphenyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109106519 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 5-N-(1,1-dioxothiolan-3-yl)-3-N-(3-methoxyphenyl)pyridine-3,5-dicarboxamide |
| SMILES | COc1cccc(NC(=O)c2cncc(C(=O)NC3CCS(=O)(=O)C3)c2)c1 |
| InChI | InChI=1S/C18H19N3O5S/c1-26-16-4-2-3-14(8-16)20-17(22)12-7-13(10-19-9-12)18(23)21-15-5-6-27(24,25)11-15/h2-4,7-10,15H,5-6,11H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | OVTJLFZXQMXSQK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |