C17H19N3O4S — CID 113028619
N-[5-[(1,1-dioxothiolan-3-yl)amino]-2-pyridinyl]-3-methoxybenzamide (PubChem CID 113028619) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is N-[5-[(1,1-dioxothiolan-3-yl)amino]-2-pyridinyl]-3-methoxybenzamide.
| Compound Name | N-[5-[(1,1-dioxothiolan-3-yl)amino]-2-pyridinyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 113028619 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N-[5-[(1,1-dioxothiolan-3-yl)amino]-2-pyridinyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(NC3CCS(=O)(=O)C3)cn2)c1 |
| InChI | InChI=1S/C17H19N3O4S/c1-24-15-4-2-3-12(9-15)17(21)20-16-6-5-13(10-18-16)19-14-7-8-25(22,23)11-14/h2-6,9-10,14,19H,7-8,11H2,1H3,(H,18,20,21) |
| InChIKey | FFXSCZMWVSTKJN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |