C16H17N3O3S — CID 113028611
N-[5-[(1,1-dioxothiolan-3-yl)amino]-2-pyridinyl]benzamide (PubChem CID 113028611) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is N-[5-[(1,1-dioxothiolan-3-yl)amino]-2-pyridinyl]benzamide.
| Compound Name | N-[5-[(1,1-dioxothiolan-3-yl)amino]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 113028611 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-[5-[(1,1-dioxothiolan-3-yl)amino]-2-pyridinyl]benzamide |
| SMILES | O=C(Nc1ccc(NC2CCS(=O)(=O)C2)cn1)c1ccccc1 |
| InChI | InChI=1S/C16H17N3O3S/c20-16(12-4-2-1-3-5-12)19-15-7-6-13(10-17-15)18-14-8-9-23(21,22)11-14/h1-7,10,14,18H,8-9,11H2,(H,17,19,20) |
| InChIKey | QITGMZUKJSLWQX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |