C16H18N4O3S — CID 113028652
1-[5-[(1,1-dioxothiolan-3-yl)amino]-2-pyridinyl]-3-phenylurea (PubChem CID 113028652) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is 1-[5-[(1,1-dioxothiolan-3-yl)amino]-2-pyridinyl]-3-phenylurea.
| Compound Name | 1-[5-[(1,1-dioxothiolan-3-yl)amino]-2-pyridinyl]-3-phenylurea |
|---|---|
| PubChem CID | 113028652 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1-[5-[(1,1-dioxothiolan-3-yl)amino]-2-pyridinyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(NC2CCS(=O)(=O)C2)cn1 |
| InChI | InChI=1S/C16H18N4O3S/c21-16(19-12-4-2-1-3-5-12)20-15-7-6-13(10-17-15)18-14-8-9-24(22,23)11-14/h1-7,10,14,18H,8-9,11H2,(H2,17,19,20,21) |
| InChIKey | BCNGGCZSLBPTJX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |