C16H16ClN3O3S — CID 109193168
N-(3-chlorophenyl)-5-[(1,1-dioxothiolan-3-yl)amino]pyridine-2-carboxamide (PubChem CID 109193168) has the molecular formula C16H16ClN3O3S and a molecular weight of 365.84 g/mol. Its IUPAC name is N-(3-chlorophenyl)-5-[(1,1-dioxothiolan-3-yl)amino]pyridine-2-carboxamide.
| Compound Name | N-(3-chlorophenyl)-5-[(1,1-dioxothiolan-3-yl)amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109193168 |
| Molecular Formula | C16H16ClN3O3S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N-(3-chlorophenyl)-5-[(1,1-dioxothiolan-3-yl)amino]pyridine-2-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1ccc(NC2CCS(=O)(=O)C2)cn1 |
| InChI | InChI=1S/C16H16ClN3O3S/c17-11-2-1-3-12(8-11)20-16(21)15-5-4-13(9-18-15)19-14-6-7-24(22,23)10-14/h1-5,8-9,14,19H,6-7,10H2,(H,20,21) |
| InChIKey | DTBYGOIIBDNPSX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |