C17H17ClN2O3S — CID 112983803
3-chloro-N-[4-[(1,1-dioxothiolan-3-yl)amino]phenyl]benzamide (PubChem CID 112983803) has the molecular formula C17H17ClN2O3S and a molecular weight of 364.85 g/mol. Its IUPAC name is 3-chloro-N-[4-[(1,1-dioxothiolan-3-yl)amino]phenyl]benzamide.
| Compound Name | 3-chloro-N-[4-[(1,1-dioxothiolan-3-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 112983803 |
| Molecular Formula | C17H17ClN2O3S |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 3-chloro-N-[4-[(1,1-dioxothiolan-3-yl)amino]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(NC2CCS(=O)(=O)C2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H17ClN2O3S/c18-13-3-1-2-12(10-13)17(21)20-15-6-4-14(5-7-15)19-16-8-9-24(22,23)11-16/h1-7,10,16,19H,8-9,11H2,(H,20,21) |
| InChIKey | BLHIOTUJAOYBDS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |