C20H21N3O5S — CID 42655672
N-(3-acetylphenyl)-4-[(1,1-dioxothiolan-3-yl)carbamoylamino]benzamide (PubChem CID 42655672) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is N-(3-acetylphenyl)-4-[(1,1-dioxothiolan-3-yl)carbamoylamino]benzamide.
| Compound Name | N-(3-acetylphenyl)-4-[(1,1-dioxothiolan-3-yl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 42655672 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N-(3-acetylphenyl)-4-[(1,1-dioxothiolan-3-yl)carbamoylamino]benzamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2ccc(NC(=O)NC3CCS(=O)(=O)C3)cc2)c1 |
| InChI | InChI=1S/C20H21N3O5S/c1-13(24)15-3-2-4-17(11-15)21-19(25)14-5-7-16(8-6-14)22-20(26)23-18-9-10-29(27,28)12-18/h2-8,11,18H,9-10,12H2,1H3,(H,21,25)(H2,22,23,26) |
| InChIKey | CXGOEKPETRWKSN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |