C18H19N3O4S — CID 109159393
6-(3-acetylanilino)-N-(1,1-dioxothiolan-3-yl)pyridine-3-carboxamide (PubChem CID 109159393) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is 6-(3-acetylanilino)-N-(1,1-dioxothiolan-3-yl)pyridine-3-carboxamide.
| Compound Name | 6-(3-acetylanilino)-N-(1,1-dioxothiolan-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109159393 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 6-(3-acetylanilino)-N-(1,1-dioxothiolan-3-yl)pyridine-3-carboxamide |
| SMILES | CC(=O)c1cccc(Nc2ccc(C(=O)NC3CCS(=O)(=O)C3)cn2)c1 |
| InChI | InChI=1S/C18H19N3O4S/c1-12(22)13-3-2-4-15(9-13)20-17-6-5-14(10-19-17)18(23)21-16-7-8-26(24,25)11-16/h2-6,9-10,16H,7-8,11H2,1H3,(H,19,20)(H,21,23) |
| InChIKey | RXCJSVWVZVMGSI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |