C18H20N4O4S — CID 109159396
6-(4-acetamidoanilino)-N-(1,1-dioxothiolan-3-yl)pyridine-3-carboxamide (PubChem CID 109159396) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is 6-(4-acetamidoanilino)-N-(1,1-dioxothiolan-3-yl)pyridine-3-carboxamide.
| Compound Name | 6-(4-acetamidoanilino)-N-(1,1-dioxothiolan-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109159396 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 6-(4-acetamidoanilino)-N-(1,1-dioxothiolan-3-yl)pyridine-3-carboxamide |
| SMILES | CC(=O)Nc1ccc(Nc2ccc(C(=O)NC3CCS(=O)(=O)C3)cn2)cc1 |
| InChI | InChI=1S/C18H20N4O4S/c1-12(23)20-14-3-5-15(6-4-14)21-17-7-2-13(10-19-17)18(24)22-16-8-9-27(25,26)11-16/h2-7,10,16H,8-9,11H2,1H3,(H,19,21)(H,20,23)(H,22,24) |
| InChIKey | JULMKYPIQDGPJF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |