C17H18ClN3O4S — CID 109159378
6-(5-chloro-2-methoxyanilino)-N-(1,1-dioxothiolan-3-yl)pyridine-3-carboxamide (PubChem CID 109159378) has the molecular formula C17H18ClN3O4S and a molecular weight of 395.87 g/mol. Its IUPAC name is 6-(5-chloro-2-methoxyanilino)-N-(1,1-dioxothiolan-3-yl)pyridine-3-carboxamide.
| Compound Name | 6-(5-chloro-2-methoxyanilino)-N-(1,1-dioxothiolan-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109159378 |
| Molecular Formula | C17H18ClN3O4S |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 6-(5-chloro-2-methoxyanilino)-N-(1,1-dioxothiolan-3-yl)pyridine-3-carboxamide |
| SMILES | COc1ccc(Cl)cc1Nc1ccc(C(=O)NC2CCS(=O)(=O)C2)cn1 |
| InChI | InChI=1S/C17H18ClN3O4S/c1-25-15-4-3-12(18)8-14(15)21-16-5-2-11(9-19-16)17(22)20-13-6-7-26(23,24)10-13/h2-5,8-9,13H,6-7,10H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | OIJFUHWBBMBPNN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |