C16H19ClN2O5S — CID 108977981
1-N'-(5-chloro-2-methoxyphenyl)-1-N-(1,1-dioxothiolan-3-yl)cyclopropane-1,1-dicarboxamide (PubChem CID 108977981) has the molecular formula C16H19ClN2O5S and a molecular weight of 386.86 g/mol. Its IUPAC name is 1-N'-(5-chloro-2-methoxyphenyl)-1-N-(1,1-dioxothiolan-3-yl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(5-chloro-2-methoxyphenyl)-1-N-(1,1-dioxothiolan-3-yl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108977981 |
| Molecular Formula | C16H19ClN2O5S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 1-N'-(5-chloro-2-methoxyphenyl)-1-N-(1,1-dioxothiolan-3-yl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)C1(C(=O)NC2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C16H19ClN2O5S/c1-24-13-3-2-10(17)8-12(13)19-15(21)16(5-6-16)14(20)18-11-4-7-25(22,23)9-11/h2-3,8,11H,4-7,9H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | ARVIDRYDPUBKIM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|