C17H18N4O5S — CID 109285220
methyl 3-[[5-[(1,1-dioxothiolan-3-yl)carbamoyl]pyrazin-2-yl]amino]benzoate (PubChem CID 109285220) has the molecular formula C17H18N4O5S and a molecular weight of 390.42 g/mol. Its IUPAC name is methyl 3-[[5-[(1,1-dioxothiolan-3-yl)carbamoyl]pyrazin-2-yl]amino]benzoate.
| Compound Name | methyl 3-[[5-[(1,1-dioxothiolan-3-yl)carbamoyl]pyrazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 109285220 |
| Molecular Formula | C17H18N4O5S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | methyl 3-[[5-[(1,1-dioxothiolan-3-yl)carbamoyl]pyrazin-2-yl]amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2cnc(C(=O)NC3CCS(=O)(=O)C3)cn2)c1 |
| InChI | InChI=1S/C17H18N4O5S/c1-26-17(23)11-3-2-4-12(7-11)20-15-9-18-14(8-19-15)16(22)21-13-5-6-27(24,25)10-13/h2-4,7-9,13H,5-6,10H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | FVYCFCNLNWWHBT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |