C15H20N2O5S — CID 109026383
methyl 3-[[3-[(1,1-dioxothiolan-3-yl)amino]-3-oxopropyl]amino]benzoate (PubChem CID 109026383) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is methyl 3-[[3-[(1,1-dioxothiolan-3-yl)amino]-3-oxopropyl]amino]benzoate.
| Compound Name | methyl 3-[[3-[(1,1-dioxothiolan-3-yl)amino]-3-oxopropyl]amino]benzoate |
|---|---|
| PubChem CID | 109026383 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | methyl 3-[[3-[(1,1-dioxothiolan-3-yl)amino]-3-oxopropyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NCCC(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C15H20N2O5S/c1-22-15(19)11-3-2-4-12(9-11)16-7-5-14(18)17-13-6-8-23(20,21)10-13/h2-4,9,13,16H,5-8,10H2,1H3,(H,17,18) |
| InChIKey | YZRSNCDFBKHIHV-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |