C13H16Cl2N2O3S — CID 109026419
3-(2,3-dichloroanilino)-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 109026419) has the molecular formula C13H16Cl2N2O3S and a molecular weight of 351.26 g/mol. Its IUPAC name is 3-(2,3-dichloroanilino)-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-(2,3-dichloroanilino)-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 109026419 |
| Molecular Formula | C13H16Cl2N2O3S |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 3-(2,3-dichloroanilino)-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | O=C(CCNc1cccc(Cl)c1Cl)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16Cl2N2O3S/c14-10-2-1-3-11(13(10)15)16-6-4-12(18)17-9-5-7-21(19,20)8-9/h1-3,9,16H,4-8H2,(H,17,18) |
| InChIKey | HUIMQBBMHYBGHH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |