C14H17ClN2O4S — CID 17471003
2-chloro-N-[3-[(1,1-dioxothiolan-3-yl)amino]-3-oxopropyl]benzamide (PubChem CID 17471003) has the molecular formula C14H17ClN2O4S and a molecular weight of 344.82 g/mol. Its IUPAC name is 2-chloro-N-[3-[(1,1-dioxothiolan-3-yl)amino]-3-oxopropyl]benzamide.
| Compound Name | 2-chloro-N-[3-[(1,1-dioxothiolan-3-yl)amino]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 17471003 |
| Molecular Formula | C14H17ClN2O4S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 2-chloro-N-[3-[(1,1-dioxothiolan-3-yl)amino]-3-oxopropyl]benzamide |
| SMILES | O=C(CCNC(=O)c1ccccc1Cl)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H17ClN2O4S/c15-12-4-2-1-3-11(12)14(19)16-7-5-13(18)17-10-6-8-22(20,21)9-10/h1-4,10H,5-9H2,(H,16,19)(H,17,18) |
| InChIKey | OYIFHNVWEIMMMP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |