C12H14ClNO4S — CID 6601206
2-(2-chlorophenoxy)-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 6601206) has the molecular formula C12H14ClNO4S and a molecular weight of 303.77 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 6601206 |
| Molecular Formula | C12H14ClNO4S |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | O=C(COc1ccccc1Cl)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14ClNO4S/c13-10-3-1-2-4-11(10)18-7-12(15)14-9-5-6-19(16,17)8-9/h1-4,9H,5-8H2,(H,14,15)/t9-/m0/s1 |
| InChIKey | BVAGZEPINDCNKV-VIFPVBQESA-N |
| XLogP | 1.02 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |