C12H13Cl2NO4S — CID 2853637
2-(2,4-dichlorophenoxy)-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 2853637) has the molecular formula C12H13Cl2NO4S and a molecular weight of 338.21 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 2853637 |
| Molecular Formula | C12H13Cl2NO4S |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H13Cl2NO4S/c13-8-1-2-11(10(14)5-8)19-6-12(16)15-9-3-4-20(17,18)7-9/h1-2,5,9H,3-4,6-7H2,(H,15,16) |
| InChIKey | AGQYUFZAUXOUOX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |