C13H16BrNO4S — CID 7949213
2-(2-bromo-4-methylphenoxy)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 7949213) has the molecular formula C13H16BrNO4S and a molecular weight of 362.25 g/mol. Its IUPAC name is 2-(2-bromo-4-methylphenoxy)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-(2-bromo-4-methylphenoxy)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 7949213 |
| Molecular Formula | C13H16BrNO4S |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | 2-(2-bromo-4-methylphenoxy)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | Cc1ccc(OCC(=O)N[C@@H]2CCS(=O)(=O)C2)c(Br)c1 |
| InChI | InChI=1S/C13H16BrNO4S/c1-9-2-3-12(11(14)6-9)19-7-13(16)15-10-4-5-20(17,18)8-10/h2-3,6,10H,4-5,7-8H2,1H3,(H,15,16)/t10-/m1/s1 |
| InChIKey | YIMZCBHPZQSYLD-SNVBAGLBSA-N |
| XLogP | 1.44 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |