C17H22ClNO6S — CID 7868608
[2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate (PubChem CID 7868608) has the molecular formula C17H22ClNO6S and a molecular weight of 403.88 g/mol. Its IUPAC name is [2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate.
| Compound Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 7868608 |
| Molecular Formula | C17H22ClNO6S |
| Molecular Weight | 403.88 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)OCC(=O)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H22ClNO6S/c1-12-9-13(18)4-5-15(12)24-7-2-3-17(21)25-10-16(20)19-14-6-8-26(22,23)11-14/h4-5,9,14H,2-3,6-8,10-11H2,1H3,(H,19,20)/t14-/m1/s1 |
| InChIKey | LNUAKYUAZIMVCG-CQSZACIVSA-N |
| XLogP | 1.65 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.88 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|