C17H21ClN2O5 — CID 7868590
[2-(cyclopropylcarbamoylamino)-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate (PubChem CID 7868590) has the molecular formula C17H21ClN2O5 and a molecular weight of 368.82 g/mol. Its IUPAC name is [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate.
| Compound Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 7868590 |
| Molecular Formula | C17H21ClN2O5 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)OCC(=O)NC(=O)NC1CC1 |
| InChI | InChI=1S/C17H21ClN2O5/c1-11-9-12(18)4-7-14(11)24-8-2-3-16(22)25-10-15(21)20-17(23)19-13-5-6-13/h4,7,9,13H,2-3,5-6,8,10H2,1H3,(H2,19,20,21,23) |
| InChIKey | MGIQAKQPCIDFMN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|