C16H17ClN2O5 — CID 8579597
[2-(cyclopropylcarbamoylamino)-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate (PubChem CID 8579597) has the molecular formula C16H17ClN2O5 and a molecular weight of 352.77 g/mol. Its IUPAC name is [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate.
| Compound Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 8579597 |
| Molecular Formula | C16H17ClN2O5 |
| Molecular Weight | 352.77 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate |
| SMILES | O=C(COC(=O)CCC(=O)c1ccc(Cl)cc1)NC(=O)NC1CC1 |
| InChI | InChI=1S/C16H17ClN2O5/c17-11-3-1-10(2-4-11)13(20)7-8-15(22)24-9-14(21)19-16(23)18-12-5-6-12/h1-4,12H,5-9H2,(H2,18,19,21,23) |
| InChIKey | VNSDWFFBUWMIDR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.77 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |