C21H19ClN2O4 — CID 7675857
[2-(cyclopropylcarbamoylamino)-2-oxoethyl] (E)-2-(4-chlorophenyl)-3-phenylprop-2-enoate (PubChem CID 7675857) has the molecular formula C21H19ClN2O4 and a molecular weight of 398.85 g/mol. Its IUPAC name is [2-(cyclopropylcarbamoylamino)-2-oxoethyl] (E)-2-(4-chlorophenyl)-3-phenylprop-2-enoate.
| Compound Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] (E)-2-(4-chlorophenyl)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 7675857 |
| Molecular Formula | C21H19ClN2O4 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] (E)-2-(4-chlorophenyl)-3-phenylprop-2-enoate |
| SMILES | O=C(COC(=O)/C(=C/c1ccccc1)c1ccc(Cl)cc1)NC(=O)NC1CC1 |
| InChI | InChI=1S/C21H19ClN2O4/c22-16-8-6-15(7-9-16)18(12-14-4-2-1-3-5-14)20(26)28-13-19(25)24-21(27)23-17-10-11-17/h1-9,12,17H,10-11,13H2,(H2,23,24,25,27)/b18-12+ |
| InChIKey | OYSLHODIVIWQLX-LDADJPATSA-N |
| XLogP | 3.41 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|