C22H24N2O4S — CID 8660788
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] (Z)-3-(3-methylphenyl)-2-thiophen-2-ylprop-2-enoate (PubChem CID 8660788) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] (Z)-3-(3-methylphenyl)-2-thiophen-2-ylprop-2-enoate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] (Z)-3-(3-methylphenyl)-2-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8660788 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] (Z)-3-(3-methylphenyl)-2-thiophen-2-ylprop-2-enoate |
| SMILES | Cc1cccc(/C=C(/C(=O)OCC(=O)NC(=O)NC2CCCC2)c2cccs2)c1 |
| InChI | InChI=1S/C22H24N2O4S/c1-15-6-4-7-16(12-15)13-18(19-10-5-11-29-19)21(26)28-14-20(25)24-22(27)23-17-8-2-3-9-17/h4-7,10-13,17H,2-3,8-9,14H2,1H3,(H2,23,24,25,27)/b18-13+ |
| InChIKey | SETLXFOEJBKGRX-QGOAFFKASA-N |
| XLogP | 3.91 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|