C22H24N2O4S — CID 8632833
[2-[(3R)-3-carbamoylpiperidin-1-yl]-2-oxoethyl] (Z)-3-(3-methylphenyl)-2-thiophen-2-ylprop-2-enoate (PubChem CID 8632833) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is [2-[(3R)-3-carbamoylpiperidin-1-yl]-2-oxoethyl] (Z)-3-(3-methylphenyl)-2-thiophen-2-ylprop-2-enoate.
| Compound Name | [2-[(3R)-3-carbamoylpiperidin-1-yl]-2-oxoethyl] (Z)-3-(3-methylphenyl)-2-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8632833 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | [2-[(3R)-3-carbamoylpiperidin-1-yl]-2-oxoethyl] (Z)-3-(3-methylphenyl)-2-thiophen-2-ylprop-2-enoate |
| SMILES | Cc1cccc(/C=C(/C(=O)OCC(=O)N2CCC[C@@H](C(N)=O)C2)c2cccs2)c1 |
| InChI | InChI=1S/C22H24N2O4S/c1-15-5-2-6-16(11-15)12-18(19-8-4-10-29-19)22(27)28-14-20(25)24-9-3-7-17(13-24)21(23)26/h2,4-6,8,10-12,17H,3,7,9,13-14H2,1H3,(H2,23,26)/b18-12+/t17-/m1/s1 |
| InChIKey | SFNRZHYARIDCIO-YPOUMIDOSA-N |
| XLogP | 2.86 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|