C18H19NO3S2 — CID 2363001
(2-oxo-2-piperidin-1-ylethyl) (Z)-2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 2363001) has the molecular formula C18H19NO3S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) (Z)-2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) (Z)-2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 2363001 |
| Molecular Formula | C18H19NO3S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) (Z)-2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | O=C(OCC(=O)N1CCCCC1)/C(=C/c1cccs1)c1cccs1 |
| InChI | InChI=1S/C18H19NO3S2/c20-17(19-8-2-1-3-9-19)13-22-18(21)15(16-7-5-11-24-16)12-14-6-4-10-23-14/h4-7,10-12H,1-3,8-9,13H2/b15-12+ |
| InChIKey | KSYSLSIMNDLMBG-NTCAYCPXSA-N |
| XLogP | 3.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|