C21H16O5S2 — CID 8819381
[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 8819381) has the molecular formula C21H16O5S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8819381 |
| Molecular Formula | C21H16O5S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | O=C(OCC(=O)c1ccc2c(c1)OCCO2)/C(=C/c1cccs1)c1cccs1 |
| InChI | InChI=1S/C21H16O5S2/c22-17(14-5-6-18-19(11-14)25-8-7-24-18)13-26-21(23)16(20-4-2-10-28-20)12-15-3-1-9-27-15/h1-6,9-12H,7-8,13H2/b16-12+ |
| InChIKey | AKPUPXHAVNHVQM-FOWTUZBSSA-N |
| XLogP | 4.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|