C17H14O5 — CID 2868555
[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] benzoate (PubChem CID 2868555) has the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] benzoate.
| Compound Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] benzoate |
|---|---|
| PubChem CID | 2868555 |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] benzoate |
| SMILES | O=C(COC(=O)c1ccccc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H14O5/c18-14(11-22-17(19)12-4-2-1-3-5-12)13-6-7-15-16(10-13)21-9-8-20-15/h1-7,10H,8-9,11H2 |
| InChIKey | CLFONOHWHGMMCU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |