C24H18O6 — CID 7203763
[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 4-benzoylbenzoate (PubChem CID 7203763) has the molecular formula C24H18O6 and a molecular weight of 402.40 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 4-benzoylbenzoate.
| Compound Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 4-benzoylbenzoate |
|---|---|
| PubChem CID | 7203763 |
| Molecular Formula | C24H18O6 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 4-benzoylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(C(=O)c2ccccc2)cc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H18O6/c25-20(19-10-11-21-22(14-19)29-13-12-28-21)15-30-24(27)18-8-6-17(7-9-18)23(26)16-4-2-1-3-5-16/h1-11,14H,12-13,15H2 |
| InChIKey | CKGOJRRMSJRBSN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |