C22H21NO3S2 — CID 8819784
[2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 8819784) has the molecular formula C22H21NO3S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8819784 |
| Molecular Formula | C22H21NO3S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | Cc1cc(C(=O)COC(=O)/C(=C/c2cccs2)c2cccs2)c(C)n1C1CC1 |
| InChI | InChI=1S/C22H21NO3S2/c1-14-11-18(15(2)23(14)16-7-8-16)20(24)13-26-22(25)19(21-6-4-10-28-21)12-17-5-3-9-27-17/h3-6,9-12,16H,7-8,13H2,1-2H3/b19-12+ |
| InChIKey | AUYDRKIIAYIIEZ-XDHOZWIPSA-N |
| XLogP | 5.53 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|