C20H15FO4S2 — CID 8819298
[2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 8819298) has the molecular formula C20H15FO4S2 and a molecular weight of 402.47 g/mol. Its IUPAC name is [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8819298 |
| Molecular Formula | C20H15FO4S2 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | COc1ccc(F)cc1C(=O)COC(=O)/C(=C/c1cccs1)c1cccs1 |
| InChI | InChI=1S/C20H15FO4S2/c1-24-18-7-6-13(21)10-15(18)17(22)12-25-20(23)16(19-5-3-9-27-19)11-14-4-2-8-26-14/h2-11H,12H2,1H3/b16-11+ |
| InChIKey | VASBQZXBLSQWQP-LFIBNONCSA-N |
| XLogP | 4.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|