C19H16O3S3 — CID 8938650
[2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 8938650) has the molecular formula C19H16O3S3 and a molecular weight of 388.54 g/mol. Its IUPAC name is [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8938650 |
| Molecular Formula | C19H16O3S3 |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | [2-(2,5-dimethylthiophen-3-yl)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | Cc1cc(C(=O)COC(=O)/C(=C/c2cccs2)c2cccs2)c(C)s1 |
| InChI | InChI=1S/C19H16O3S3/c1-12-9-15(13(2)25-12)17(20)11-22-19(21)16(18-6-4-8-24-18)10-14-5-3-7-23-14/h3-10H,11H2,1-2H3/b16-10+ |
| InChIKey | RCAPJLZLJVREIQ-MHWRWJLKSA-N |
| XLogP | 5.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|