C15H14N2O4S2 — CID 8018132
[2-(methylcarbamoylamino)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 8018132) has the molecular formula C15H14N2O4S2 and a molecular weight of 350.42 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8018132 |
| Molecular Formula | C15H14N2O4S2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | CNC(=O)NC(=O)COC(=O)/C(=C/c1cccs1)c1cccs1 |
| InChI | InChI=1S/C15H14N2O4S2/c1-16-15(20)17-13(18)9-21-14(19)11(12-5-3-7-23-12)8-10-4-2-6-22-10/h2-8H,9H2,1H3,(H2,16,17,18,20)/b11-8+ |
| InChIKey | ZPUGXGSKLCKJKJ-DHZHZOJOSA-N |
| XLogP | 2.35 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|