C20H16ClNO3S2 — CID 2079210
[2-[(2-chlorophenyl)methylamino]-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 2079210) has the molecular formula C20H16ClNO3S2 and a molecular weight of 417.94 g/mol. Its IUPAC name is [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 2079210 |
| Molecular Formula | C20H16ClNO3S2 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | O=C(COC(=O)/C(=C/c1cccs1)c1cccs1)NCc1ccccc1Cl |
| InChI | InChI=1S/C20H16ClNO3S2/c21-17-7-2-1-5-14(17)12-22-19(23)13-25-20(24)16(18-8-4-10-27-18)11-15-6-3-9-26-15/h1-11H,12-13H2,(H,22,23)/b16-11+ |
| InChIKey | YXTMLYQDOJLYIS-LFIBNONCSA-N |
| XLogP | 4.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|