C19H14ClNO2S — CID 9401366
N-[(2-chlorophenyl)methyl]-2-(thiophene-2-carbonyl)benzamide (PubChem CID 9401366) has the molecular formula C19H14ClNO2S and a molecular weight of 355.85 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-(thiophene-2-carbonyl)benzamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-(thiophene-2-carbonyl)benzamide |
|---|---|
| PubChem CID | 9401366 |
| Molecular Formula | C19H14ClNO2S |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-(thiophene-2-carbonyl)benzamide |
| SMILES | O=C(NCc1ccccc1Cl)c1ccccc1C(=O)c1cccs1 |
| InChI | InChI=1S/C19H14ClNO2S/c20-16-9-4-1-6-13(16)12-21-19(23)15-8-3-2-7-14(15)18(22)17-10-5-11-24-17/h1-11H,12H2,(H,21,23) |
| InChIKey | CESPKIAXGBHQIO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |