C22H20ClN3O3S — CID 55842432
N-[[4-[2-[(2-chlorobenzoyl)amino]ethylcarbamoyl]phenyl]methyl]thiophene-2-carboxamide (PubChem CID 55842432) has the molecular formula C22H20ClN3O3S and a molecular weight of 441.94 g/mol. Its IUPAC name is N-[[4-[2-[(2-chlorobenzoyl)amino]ethylcarbamoyl]phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | N-[[4-[2-[(2-chlorobenzoyl)amino]ethylcarbamoyl]phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55842432 |
| Molecular Formula | C22H20ClN3O3S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | N-[[4-[2-[(2-chlorobenzoyl)amino]ethylcarbamoyl]phenyl]methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCNC(=O)c1ccccc1Cl)c1ccc(CNC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C22H20ClN3O3S/c23-18-5-2-1-4-17(18)21(28)25-12-11-24-20(27)16-9-7-15(8-10-16)14-26-22(29)19-6-3-13-30-19/h1-10,13H,11-12,14H2,(H,24,27)(H,25,28)(H,26,29) |
| InChIKey | GBLBPQHBOVKCPA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|