C20H18ClN3O4S2 — CID 55659204
2-chloro-N-[2-[[4-(thiophen-2-ylsulfonylamino)benzoyl]amino]ethyl]benzamide (PubChem CID 55659204) has the molecular formula C20H18ClN3O4S2 and a molecular weight of 463.97 g/mol. Its IUPAC name is 2-chloro-N-[2-[[4-(thiophen-2-ylsulfonylamino)benzoyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[4-(thiophen-2-ylsulfonylamino)benzoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55659204 |
| Molecular Formula | C20H18ClN3O4S2 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | 2-chloro-N-[2-[[4-(thiophen-2-ylsulfonylamino)benzoyl]amino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1ccccc1Cl)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C20H18ClN3O4S2/c21-17-5-2-1-4-16(17)20(26)23-12-11-22-19(25)14-7-9-15(10-8-14)24-30(27,28)18-6-3-13-29-18/h1-10,13,24H,11-12H2,(H,22,25)(H,23,26) |
| InChIKey | FUOAQSXLQNLLPF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|