C20H20N2O4S2 — CID 55727615
N-[[3-(methoxymethyl)phenyl]methyl]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 55727615) has the molecular formula C20H20N2O4S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is N-[[3-(methoxymethyl)phenyl]methyl]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[[3-(methoxymethyl)phenyl]methyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 55727615 |
| Molecular Formula | C20H20N2O4S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | N-[[3-(methoxymethyl)phenyl]methyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | COCc1cccc(CNC(=O)c2ccc(NS(=O)(=O)c3cccs3)cc2)c1 |
| InChI | InChI=1S/C20H20N2O4S2/c1-26-14-16-5-2-4-15(12-16)13-21-20(23)17-7-9-18(10-8-17)22-28(24,25)19-6-3-11-27-19/h2-12,22H,13-14H2,1H3,(H,21,23) |
| InChIKey | OXKGNASXKJHQNY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |