C25H22N2O4S2 — CID 55954536
N-[[3-(phenoxymethyl)phenyl]methyl]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 55954536) has the molecular formula C25H22N2O4S2 and a molecular weight of 478.60 g/mol. Its IUPAC name is N-[[3-(phenoxymethyl)phenyl]methyl]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[[3-(phenoxymethyl)phenyl]methyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 55954536 |
| Molecular Formula | C25H22N2O4S2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | N-[[3-(phenoxymethyl)phenyl]methyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(NCc1cccc(COc2ccccc2)c1)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C25H22N2O4S2/c28-25(21-11-13-22(14-12-21)27-33(29,30)24-10-5-15-32-24)26-17-19-6-4-7-20(16-19)18-31-23-8-2-1-3-9-23/h1-16,27H,17-18H2,(H,26,28) |
| InChIKey | POKNGBYFRVJVMK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |