C24H22N2O5S2 — CID 39171548
N-[[3-(furan-2-ylmethoxymethyl)phenyl]methyl]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 39171548) has the molecular formula C24H22N2O5S2 and a molecular weight of 482.58 g/mol. Its IUPAC name is N-[[3-(furan-2-ylmethoxymethyl)phenyl]methyl]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[[3-(furan-2-ylmethoxymethyl)phenyl]methyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 39171548 |
| Molecular Formula | C24H22N2O5S2 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | N-[[3-(furan-2-ylmethoxymethyl)phenyl]methyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(NCc1cccc(COCc2ccco2)c1)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C24H22N2O5S2/c27-24(20-8-10-21(11-9-20)26-33(28,29)23-7-3-13-32-23)25-15-18-4-1-5-19(14-18)16-30-17-22-6-2-12-31-22/h1-14,26H,15-17H2,(H,25,27) |
| InChIKey | AXJYFCQBYOHDQM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |