C21H22N2O5S2 — CID 39207534
N-[(4-ethoxy-3-methoxyphenyl)methyl]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 39207534) has the molecular formula C21H22N2O5S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[(4-ethoxy-3-methoxyphenyl)methyl]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(4-ethoxy-3-methoxyphenyl)methyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 39207534 |
| Molecular Formula | C21H22N2O5S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | N-[(4-ethoxy-3-methoxyphenyl)methyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | CCOc1ccc(CNC(=O)c2ccc(NS(=O)(=O)c3cccs3)cc2)cc1OC |
| InChI | InChI=1S/C21H22N2O5S2/c1-3-28-18-11-6-15(13-19(18)27-2)14-22-21(24)16-7-9-17(10-8-16)23-30(25,26)20-5-4-12-29-20/h4-13,23H,3,14H2,1-2H3,(H,22,24) |
| InChIKey | IJPMJFRQFSCWJG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |