C22H24N2O5S2 — CID 39678609
N-(2,5-diethoxyphenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide (PubChem CID 39678609) has the molecular formula C22H24N2O5S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide.
| Compound Name | N-(2,5-diethoxyphenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 39678609 |
| Molecular Formula | C22H24N2O5S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)Cc2ccc(NS(=O)(=O)c3cccs3)cc2)c1 |
| InChI | InChI=1S/C22H24N2O5S2/c1-3-28-18-11-12-20(29-4-2)19(15-18)23-21(25)14-16-7-9-17(10-8-16)24-31(26,27)22-6-5-13-30-22/h5-13,15,24H,3-4,14H2,1-2H3,(H,23,25) |
| InChIKey | KSOVZUPOIQRALD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |