C18H15BrN2O3S2 — CID 39191280
N-(3-bromophenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide (PubChem CID 39191280) has the molecular formula C18H15BrN2O3S2 and a molecular weight of 451.37 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide.
| Compound Name | N-(3-bromophenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 39191280 |
| Molecular Formula | C18H15BrN2O3S2 |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | N-(3-bromophenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(NS(=O)(=O)c2cccs2)cc1)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C18H15BrN2O3S2/c19-14-3-1-4-16(12-14)20-17(22)11-13-6-8-15(9-7-13)21-26(23,24)18-5-2-10-25-18/h1-10,12,21H,11H2,(H,20,22) |
| InChIKey | RHSNDEVIGIDECH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |