C12H10BrNO3S2 — CID 47268843
2-(4-bromophenyl)-N-thiophen-2-ylsulfonylacetamide (PubChem CID 47268843) has the molecular formula C12H10BrNO3S2 and a molecular weight of 360.25 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-thiophen-2-ylsulfonylacetamide.
| Compound Name | 2-(4-bromophenyl)-N-thiophen-2-ylsulfonylacetamide |
|---|---|
| PubChem CID | 47268843 |
| Molecular Formula | C12H10BrNO3S2 |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 358.93 |
| IUPAC Name | 2-(4-bromophenyl)-N-thiophen-2-ylsulfonylacetamide |
| SMILES | O=C(Cc1ccc(Br)cc1)NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C12H10BrNO3S2/c13-10-5-3-9(4-6-10)8-11(15)14-19(16,17)12-2-1-7-18-12/h1-7H,8H2,(H,14,15) |
| InChIKey | TVFKBCDWGIFFEY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |