C6H10N4O4S2 — CID 19065180
thiophen-2-ylsulfonylurea;urea (PubChem CID 19065180) has the molecular formula C6H10N4O4S2 and a molecular weight of 266.30 g/mol. Its IUPAC name is thiophen-2-ylsulfonylurea;urea.
| Compound Name | thiophen-2-ylsulfonylurea;urea |
|---|---|
| PubChem CID | 19065180 |
| Molecular Formula | C6H10N4O4S2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | thiophen-2-ylsulfonylurea;urea |
| SMILES | NC(=O)NS(=O)(=O)c1cccs1.NC(N)=O |
| InChI | InChI=1S/C5H6N2O3S2.CH4N2O/c6-5(8)7-12(9,10)4-2-1-3-11-4;2-1(3)4/h1-3H,(H3,6,7,8);(H4,2,3,4) |
| InChIKey | SRVZFBQIRIJRJU-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 158.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |