C8H9NO3S2 — CID 47232134
N-thiophen-2-ylsulfonylcyclopropanecarboxamide (PubChem CID 47232134) has the molecular formula C8H9NO3S2 and a molecular weight of 231.30 g/mol. Its IUPAC name is N-thiophen-2-ylsulfonylcyclopropanecarboxamide.
| Compound Name | N-thiophen-2-ylsulfonylcyclopropanecarboxamide |
|---|---|
| PubChem CID | 47232134 |
| Molecular Formula | C8H9NO3S2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | N-thiophen-2-ylsulfonylcyclopropanecarboxamide |
| SMILES | O=C(NS(=O)(=O)c1cccs1)C1CC1 |
| InChI | InChI=1S/C8H9NO3S2/c10-8(6-3-4-6)9-14(11,12)7-2-1-5-13-7/h1-2,5-6H,3-4H2,(H,9,10) |
| InChIKey | JMNYGWPPYREJEW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |