C15H24N2O3S2 — CID 27511485
N-[(2S)-3-methylbutan-2-yl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 27511485) has the molecular formula C15H24N2O3S2 and a molecular weight of 344.50 g/mol. Its IUPAC name is N-[(2S)-3-methylbutan-2-yl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(2S)-3-methylbutan-2-yl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 27511485 |
| Molecular Formula | C15H24N2O3S2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-[(2S)-3-methylbutan-2-yl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | CC(C)[C@H](C)NC(=O)C1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C15H24N2O3S2/c1-11(2)12(3)16-15(18)13-6-8-17(9-7-13)22(19,20)14-5-4-10-21-14/h4-5,10-13H,6-9H2,1-3H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | SPFDNDWKLAYXSF-LBPRGKRZSA-N |
| XLogP | 2.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |