C15H23N3O4S2 — CID 8750729
N-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 8750729) has the molecular formula C15H23N3O4S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 8750729 |
| Molecular Formula | C15H23N3O4S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | CCNC(=O)[C@H](C)NC(=O)C1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C15H23N3O4S2/c1-3-16-14(19)11(2)17-15(20)12-6-8-18(9-7-12)24(21,22)13-5-4-10-23-13/h4-5,10-12H,3,6-9H2,1-2H3,(H,16,19)(H,17,20)/t11-/m0/s1 |
| InChIKey | GFBNJGGXGPIKSM-NSHDSACASA-N |
| XLogP | 0.79 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |