C20H25ClN2O3S2 — CID 46693048
N-[1-(4-chlorophenyl)-2-methylpropyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 46693048) has the molecular formula C20H25ClN2O3S2 and a molecular weight of 441.02 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2-methylpropyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[1-(4-chlorophenyl)-2-methylpropyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 46693048 |
| Molecular Formula | C20H25ClN2O3S2 |
| Molecular Weight | 441.02 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2-methylpropyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | CC(C)C(NC(=O)C1CCN(S(=O)(=O)c2cccs2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H25ClN2O3S2/c1-14(2)19(15-5-7-17(21)8-6-15)22-20(24)16-9-11-23(12-10-16)28(25,26)18-4-3-13-27-18/h3-8,13-14,16,19H,9-12H2,1-2H3,(H,22,24) |
| InChIKey | WHPWNSYDIHLQQQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.02 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |