C18H24N2O4S2 — CID 9141771
N-[(2R)-4-(furan-2-yl)butan-2-yl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 9141771) has the molecular formula C18H24N2O4S2 and a molecular weight of 396.53 g/mol. Its IUPAC name is N-[(2R)-4-(furan-2-yl)butan-2-yl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(2R)-4-(furan-2-yl)butan-2-yl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 9141771 |
| Molecular Formula | C18H24N2O4S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N-[(2R)-4-(furan-2-yl)butan-2-yl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | C[C@H](CCc1ccco1)NC(=O)C1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C18H24N2O4S2/c1-14(6-7-16-4-2-12-24-16)19-18(21)15-8-10-20(11-9-15)26(22,23)17-5-3-13-25-17/h2-5,12-15H,6-11H2,1H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | CXEBQJLXLZIRLH-CQSZACIVSA-N |
| XLogP | 2.88 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |