C13H21N3O4S — CID 32598215
N-[(2S)-1-(furan-2-yl)propan-2-yl]-1-sulfamoylpiperidine-4-carboxamide (PubChem CID 32598215) has the molecular formula C13H21N3O4S and a molecular weight of 315.39 g/mol. Its IUPAC name is N-[(2S)-1-(furan-2-yl)propan-2-yl]-1-sulfamoylpiperidine-4-carboxamide.
| Compound Name | N-[(2S)-1-(furan-2-yl)propan-2-yl]-1-sulfamoylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 32598215 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-[(2S)-1-(furan-2-yl)propan-2-yl]-1-sulfamoylpiperidine-4-carboxamide |
| SMILES | C[C@@H](Cc1ccco1)NC(=O)C1CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C13H21N3O4S/c1-10(9-12-3-2-8-20-12)15-13(17)11-4-6-16(7-5-11)21(14,18)19/h2-3,8,10-11H,4-7,9H2,1H3,(H,15,17)(H2,14,18,19)/t10-/m0/s1 |
| InChIKey | JVHRMWIVTLOUKK-JTQLQIEISA-N |
| XLogP | 0.24 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |